methyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate

C13H13NO3S — CID 121397503

IUPACmethyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate
SMILESCCc1cnc(-c2cc(O)cc(C(=O)OC)c2)s1
InChIInChI=1S/C13H13NO3S/c1-3-11-7-14-12(18-11)8-4-9(13(16)17-2)6-10(15)5-8/h4-7,15H,3H2,1-2H3
InChIKeyMRLSPHJMTUUKAG-UHFFFAOYSA-N
MW263.32 g/mol
LogP2.86
Rot. Bonds3

About methyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate

methyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate (PubChem CID 121397503) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is methyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate.

Molecular Properties

Compound Namemethyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate
PubChem CID121397503
Molecular FormulaC13H13NO3S
Molecular Weight263.32 g/mol
Exact Mass263.06
IUPAC Namemethyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate
SMILESCCc1cnc(-c2cc(O)cc(C(=O)OC)c2)s1
InChIInChI=1S/C13H13NO3S/c1-3-11-7-14-12(18-11)8-4-9(13(16)17-2)6-10(15)5-8/h4-7,15H,3H2,1-2H3
InChIKeyMRLSPHJMTUUKAG-UHFFFAOYSA-N
XLogP2.86
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.32
LogP ≤ 52.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate?
The IUPAC name of methyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate (CID 121397503) is methyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate.
What is the SMILES notation for methyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate?
The canonical SMILES for methyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate is CCc1cnc(-c2cc(O)cc(C(=O)OC)c2)s1.
What is the InChIKey of methyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate?
The InChIKey is MRLSPHJMTUUKAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S/c1-3-11-7-14-12(18-11)8-4-9(13(16)17-2)6-10(15)5-8/h4-7,15H,3H2,1-2H3.
What are the key properties of methyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate?
methyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate has a molecular weight of 263.32 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(5-ethyl-1,3-thiazol-2-yl)-5-hydroxybenzoate is sourced from PubChem (CID 121397503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).