C14H18N4O3S — CID 121398492
2-amino-N-(2-cyanoethyl)-5-[(1-methylcyclopropyl)sulfamoyl]benzamide (PubChem CID 121398492) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is 2-amino-N-(2-cyanoethyl)-5-[(1-methylcyclopropyl)sulfamoyl]benzamide.
| Compound Name | 2-amino-N-(2-cyanoethyl)-5-[(1-methylcyclopropyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 121398492 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-amino-N-(2-cyanoethyl)-5-[(1-methylcyclopropyl)sulfamoyl]benzamide |
| SMILES | CC1(NS(=O)(=O)c2ccc(N)c(C(=O)NCCC#N)c2)CC1 |
| InChI | InChI=1S/C14H18N4O3S/c1-14(5-6-14)18-22(20,21)10-3-4-12(16)11(9-10)13(19)17-8-2-7-15/h3-4,9,18H,2,5-6,8,16H2,1H3,(H,17,19) |
| InChIKey | PMGXQOWHEGVVHK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|