C28H28F3N3 — CID 121402825
8-methyl-N-(4-methylpentyl)-2-[3-phenyl-5-(trifluoromethyl)phenyl]quinazolin-4-amine (PubChem CID 121402825) has the molecular formula C28H28F3N3 and a molecular weight of 463.55 g/mol. Its IUPAC name is 8-methyl-N-(4-methylpentyl)-2-[3-phenyl-5-(trifluoromethyl)phenyl]quinazolin-4-amine.
| Compound Name | 8-methyl-N-(4-methylpentyl)-2-[3-phenyl-5-(trifluoromethyl)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 121402825 |
| Molecular Formula | C28H28F3N3 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 8-methyl-N-(4-methylpentyl)-2-[3-phenyl-5-(trifluoromethyl)phenyl]quinazolin-4-amine |
| SMILES | Cc1cccc2c(NCCCC(C)C)nc(-c3cc(-c4ccccc4)cc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C28H28F3N3/c1-18(2)9-8-14-32-27-24-13-7-10-19(3)25(24)33-26(34-27)22-15-21(20-11-5-4-6-12-20)16-23(17-22)28(29,30)31/h4-7,10-13,15-18H,8-9,14H2,1-3H3,(H,32,33,34) |
| InChIKey | YCTXZWAKNIXCPI-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|