C31H34F3N5O — CID 121402864
N',N'-dimethyl-N-[8-methyl-7-morpholin-4-yl-2-[3-phenyl-5-(trifluoromethyl)phenyl]quinazolin-4-yl]propane-1,3-diamine (PubChem CID 121402864) has the molecular formula C31H34F3N5O and a molecular weight of 549.64 g/mol. Its IUPAC name is N',N'-dimethyl-N-[8-methyl-7-morpholin-4-yl-2-[3-phenyl-5-(trifluoromethyl)phenyl]quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[8-methyl-7-morpholin-4-yl-2-[3-phenyl-5-(trifluoromethyl)phenyl]quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 121402864 |
| Molecular Formula | C31H34F3N5O |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | N',N'-dimethyl-N-[8-methyl-7-morpholin-4-yl-2-[3-phenyl-5-(trifluoromethyl)phenyl]quinazolin-4-yl]propane-1,3-diamine |
| SMILES | Cc1c(N2CCOCC2)ccc2c(NCCCN(C)C)nc(-c3cc(-c4ccccc4)cc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C31H34F3N5O/c1-21-27(39-14-16-40-17-15-39)11-10-26-28(21)36-29(37-30(26)35-12-7-13-38(2)3)24-18-23(22-8-5-4-6-9-22)19-25(20-24)31(32,33)34/h4-6,8-11,18-20H,7,12-17H2,1-3H3,(H,35,36,37) |
| InChIKey | NYJZCEWDFCCFPN-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|