C15H19ClN6O — CID 121410167
5-amino-3-[4-(4-chloropiperidin-1-yl)anilino]-1H-pyrazole-4-carboxamide (PubChem CID 121410167) has the molecular formula C15H19ClN6O and a molecular weight of 334.81 g/mol. Its IUPAC name is 5-amino-3-[4-(4-chloropiperidin-1-yl)anilino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[4-(4-chloropiperidin-1-yl)anilino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121410167 |
| Molecular Formula | C15H19ClN6O |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 5-amino-3-[4-(4-chloropiperidin-1-yl)anilino]-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(Nc2ccc(N3CCC(Cl)CC3)cc2)n[nH]c1N |
| InChI | InChI=1S/C15H19ClN6O/c16-9-5-7-22(8-6-9)11-3-1-10(2-4-11)19-15-12(14(18)23)13(17)20-21-15/h1-4,9H,5-8H2,(H2,18,23)(H4,17,19,20,21) |
| InChIKey | ITTSMVXSYCXEEV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|