C20H32ClN3O4S — CID 121410334
tert-butyl 4-[2-(4-chlorophenyl)ethyl-(2-sulfamoylethyl)amino]piperidine-1-carboxylate (PubChem CID 121410334) has the molecular formula C20H32ClN3O4S and a molecular weight of 446.01 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-chlorophenyl)ethyl-(2-sulfamoylethyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-chlorophenyl)ethyl-(2-sulfamoylethyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 121410334 |
| Molecular Formula | C20H32ClN3O4S |
| Molecular Weight | 446.01 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | tert-butyl 4-[2-(4-chlorophenyl)ethyl-(2-sulfamoylethyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(CCc2ccc(Cl)cc2)CCS(N)(=O)=O)CC1 |
| InChI | InChI=1S/C20H32ClN3O4S/c1-20(2,3)28-19(25)24-12-9-18(10-13-24)23(14-15-29(22,26)27)11-8-16-4-6-17(21)7-5-16/h4-7,18H,8-15H2,1-3H3,(H2,22,26,27) |
| InChIKey | CUMCJCOBFSARPO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.01 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |