C26H33ClN2O4 — CID 174868522
tert-butyl 4-[benzoyloxymethyl-[2-(4-chlorophenyl)ethyl]amino]piperidine-1-carboxylate (PubChem CID 174868522) has the molecular formula C26H33ClN2O4 and a molecular weight of 473.01 g/mol. Its IUPAC name is tert-butyl 4-[benzoyloxymethyl-[2-(4-chlorophenyl)ethyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[benzoyloxymethyl-[2-(4-chlorophenyl)ethyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174868522 |
| Molecular Formula | C26H33ClN2O4 |
| Molecular Weight | 473.01 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | tert-butyl 4-[benzoyloxymethyl-[2-(4-chlorophenyl)ethyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(CCc2ccc(Cl)cc2)COC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H33ClN2O4/c1-26(2,3)33-25(31)28-17-14-23(15-18-28)29(16-13-20-9-11-22(27)12-10-20)19-32-24(30)21-7-5-4-6-8-21/h4-12,23H,13-19H2,1-3H3 |
| InChIKey | OTVJRZXBXABHDQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.01 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|