C20H20FN7O — CID 121416975
N-[2-[(4-cyano-2-pyridinyl)-methylamino]ethyl]-N-ethyl-2-fluoro-6-(triazol-2-yl)benzamide (PubChem CID 121416975) has the molecular formula C20H20FN7O and a molecular weight of 393.43 g/mol. Its IUPAC name is N-[2-[(4-cyano-2-pyridinyl)-methylamino]ethyl]-N-ethyl-2-fluoro-6-(triazol-2-yl)benzamide.
| Compound Name | N-[2-[(4-cyano-2-pyridinyl)-methylamino]ethyl]-N-ethyl-2-fluoro-6-(triazol-2-yl)benzamide |
|---|---|
| PubChem CID | 121416975 |
| Molecular Formula | C20H20FN7O |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[2-[(4-cyano-2-pyridinyl)-methylamino]ethyl]-N-ethyl-2-fluoro-6-(triazol-2-yl)benzamide |
| SMILES | CCN(CCN(C)c1cc(C#N)ccn1)C(=O)c1c(F)cccc1-n1nccn1 |
| InChI | InChI=1S/C20H20FN7O/c1-3-27(12-11-26(2)18-13-15(14-22)7-8-23-18)20(29)19-16(21)5-4-6-17(19)28-24-9-10-25-28/h4-10,13H,3,11-12H2,1-2H3 |
| InChIKey | BSUZVBUCBMVFKV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 90.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |