C10H17N5O — CID 121427028
2-(diaminoamino)-N-[2-(methylamino)ethyl]benzamide (PubChem CID 121427028) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-(diaminoamino)-N-[2-(methylamino)ethyl]benzamide.
| Compound Name | 2-(diaminoamino)-N-[2-(methylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 121427028 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2-(diaminoamino)-N-[2-(methylamino)ethyl]benzamide |
| SMILES | CNCCNC(=O)c1ccccc1N(N)N |
| InChI | InChI=1S/C10H17N5O/c1-13-6-7-14-10(16)8-4-2-3-5-9(8)15(11)12/h2-5,13H,6-7,11-12H2,1H3,(H,14,16) |
| InChIKey | VJIYRVAVOVYVPV-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|