C30H34FNO2 — CID 121427056
4-[(Z)-1-[4-[(2S)-2-[(3R)-3-(fluoromethyl)pyrrolidin-1-yl]propoxy]phenyl]-2-phenylbut-1-enyl]phenol (PubChem CID 121427056) has the molecular formula C30H34FNO2 and a molecular weight of 459.61 g/mol. Its IUPAC name is 4-[(Z)-1-[4-[(2S)-2-[(3R)-3-(fluoromethyl)pyrrolidin-1-yl]propoxy]phenyl]-2-phenylbut-1-enyl]phenol.
| Compound Name | 4-[(Z)-1-[4-[(2S)-2-[(3R)-3-(fluoromethyl)pyrrolidin-1-yl]propoxy]phenyl]-2-phenylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 121427056 |
| Molecular Formula | C30H34FNO2 |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 4-[(Z)-1-[4-[(2S)-2-[(3R)-3-(fluoromethyl)pyrrolidin-1-yl]propoxy]phenyl]-2-phenylbut-1-enyl]phenol |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OC[C@H](C)N2CC[C@@H](CF)C2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H34FNO2/c1-3-29(24-7-5-4-6-8-24)30(25-9-13-27(33)14-10-25)26-11-15-28(16-12-26)34-21-22(2)32-18-17-23(19-31)20-32/h4-16,22-23,33H,3,17-21H2,1-2H3/b30-29-/t22-,23-/m0/s1 |
| InChIKey | HTMHUDFOISDPJP-GYZHAWCMSA-N |
| XLogP | 6.82 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|