C20H25N3OS — CID 121429630
N-benzyl-N-methyl-2-[(S)-(2-methylpyrazol-3-yl)-(3-methylthiophen-2-yl)methoxy]ethanamine (PubChem CID 121429630) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[(S)-(2-methylpyrazol-3-yl)-(3-methylthiophen-2-yl)methoxy]ethanamine.
| Compound Name | N-benzyl-N-methyl-2-[(S)-(2-methylpyrazol-3-yl)-(3-methylthiophen-2-yl)methoxy]ethanamine |
|---|---|
| PubChem CID | 121429630 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-benzyl-N-methyl-2-[(S)-(2-methylpyrazol-3-yl)-(3-methylthiophen-2-yl)methoxy]ethanamine |
| SMILES | Cc1ccsc1[C@@H](OCCN(C)Cc1ccccc1)c1ccnn1C |
| InChI | InChI=1S/C20H25N3OS/c1-16-10-14-25-20(16)19(18-9-11-21-23(18)3)24-13-12-22(2)15-17-7-5-4-6-8-17/h4-11,14,19H,12-13,15H2,1-3H3/t19-/m0/s1 |
| InChIKey | AJGLEAJKTQGILT-IBGZPJMESA-N |
| XLogP | 4.03 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |