About N-[1-[4-(chloromethyl)-2,5-difluorophenyl]ethyl]-2-methylpropane-2-sulfinamide
N-[1-[4-(chloromethyl)-2,5-difluorophenyl]ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 121432530) has the molecular formula C13H18ClF2NOS
and a molecular weight of 309.81 g/mol. Its IUPAC name is N-[1-[4-(chloromethyl)-2,5-difluorophenyl]ethyl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | N-[1-[4-(chloromethyl)-2,5-difluorophenyl]ethyl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 121432530 |
| Molecular Formula | C13H18ClF2NOS |
| Molecular Weight | 309.81 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-[1-[4-(chloromethyl)-2,5-difluorophenyl]ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(NS(=O)C(C)(C)C)c1cc(F)c(CCl)cc1F |
| InChI | InChI=1S/C13H18ClF2NOS/c1-8(17-19(18)13(2,3)4)10-6-11(15)9(7-14)5-12(10)16/h5-6,8,17H,7H2,1-4H3 |
| InChIKey | ZPDAETRRFHKBRC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.81 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[4-(chloromethyl)-2,5-difluorophenyl]ethyl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[4-(chloromethyl)-2,5-difluorophenyl]ethyl]-2-methylpropane-2-sulfinamide?
The IUPAC name of N-[1-[4-(chloromethyl)-2,5-difluorophenyl]ethyl]-2-methylpropane-2-sulfinamide (CID 121432530) is N-[1-[4-(chloromethyl)-2,5-difluorophenyl]ethyl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for N-[1-[4-(chloromethyl)-2,5-difluorophenyl]ethyl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for N-[1-[4-(chloromethyl)-2,5-difluorophenyl]ethyl]-2-methylpropane-2-sulfinamide is CC(NS(=O)C(C)(C)C)c1cc(F)c(CCl)cc1F.
What is the InChIKey of N-[1-[4-(chloromethyl)-2,5-difluorophenyl]ethyl]-2-methylpropane-2-sulfinamide?
The InChIKey is ZPDAETRRFHKBRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClF2NOS/c1-8(17-19(18)13(2,3)4)10-6-11(15)9(7-14)5-12(10)16/h5-6,8,17H,7H2,1-4H3.
What are the key properties of N-[1-[4-(chloromethyl)-2,5-difluorophenyl]ethyl]-2-methylpropane-2-sulfinamide?
N-[1-[4-(chloromethyl)-2,5-difluorophenyl]ethyl]-2-methylpropane-2-sulfinamide has a molecular weight of 309.81 g/mol, XLogP of 3.82, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[4-(chloromethyl)-2,5-difluorophenyl]ethyl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 121432530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).