C16H24FNOS — CID 89479061
N-[(1S)-1-[2-fluoro-4-(1-methylcyclopropyl)phenyl]ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 89479061) has the molecular formula C16H24FNOS and a molecular weight of 297.44 g/mol. Its IUPAC name is N-[(1S)-1-[2-fluoro-4-(1-methylcyclopropyl)phenyl]ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1S)-1-[2-fluoro-4-(1-methylcyclopropyl)phenyl]ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 89479061 |
| Molecular Formula | C16H24FNOS |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-[(1S)-1-[2-fluoro-4-(1-methylcyclopropyl)phenyl]ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | C[C@H](NS(=O)C(C)(C)C)c1ccc(C2(C)CC2)cc1F |
| InChI | InChI=1S/C16H24FNOS/c1-11(18-20(19)15(2,3)4)13-7-6-12(10-14(13)17)16(5)8-9-16/h6-7,10-11,18H,8-9H2,1-5H3/t11-,20?/m0/s1 |
| InChIKey | GHDRPMCEOLUCNL-ZOZMEPSFSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |