C15H20FN3OS — CID 90347565
(R)-N-[(1S)-1-[2-fluoro-4-(1H-pyrazol-4-yl)phenyl]ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 90347565) has the molecular formula C15H20FN3OS and a molecular weight of 309.41 g/mol. Its IUPAC name is (R)-N-[(1S)-1-[2-fluoro-4-(1H-pyrazol-4-yl)phenyl]ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1S)-1-[2-fluoro-4-(1H-pyrazol-4-yl)phenyl]ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 90347565 |
| Molecular Formula | C15H20FN3OS |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (R)-N-[(1S)-1-[2-fluoro-4-(1H-pyrazol-4-yl)phenyl]ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | C[C@H](N[S@](=O)C(C)(C)C)c1ccc(-c2cn[nH]c2)cc1F |
| InChI | InChI=1S/C15H20FN3OS/c1-10(19-21(20)15(2,3)4)13-6-5-11(7-14(13)16)12-8-17-18-9-12/h5-10,19H,1-4H3,(H,17,18)/t10-,21+/m0/s1 |
| InChIKey | WRMBCIRNIXBADE-CHNSCGDPSA-N |
| XLogP | 3.33 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |