C11H7F10N — CID 121435203
3-(1,1,2,3,3,4,4,5,5,5-decafluoropentan-2-yl)aniline (PubChem CID 121435203) has the molecular formula C11H7F10N and a molecular weight of 343.16 g/mol. Its IUPAC name is 3-(1,1,2,3,3,4,4,5,5,5-decafluoropentan-2-yl)aniline.
| Compound Name | 3-(1,1,2,3,3,4,4,5,5,5-decafluoropentan-2-yl)aniline |
|---|---|
| PubChem CID | 121435203 |
| Molecular Formula | C11H7F10N |
| Molecular Weight | 343.16 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 3-(1,1,2,3,3,4,4,5,5,5-decafluoropentan-2-yl)aniline |
| SMILES | Nc1cccc(C(F)(C(F)F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H7F10N/c12-7(13)8(14,5-2-1-3-6(22)4-5)9(15,16)10(17,18)11(19,20)21/h1-4,7H,22H2 |
| InChIKey | AQIORODZBZOJSI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.16 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|