C28H42N2O12 — CID 121441383
[2-[[1-hydroxy-6-[[2-methyl-1,3-di(prop-2-enoyloxy)propan-2-yl]carbamoyloxy]hexan-2-yl]oxymethylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 121441383) has the molecular formula C28H42N2O12 and a molecular weight of 598.65 g/mol. Its IUPAC name is [2-[[1-hydroxy-6-[[2-methyl-1,3-di(prop-2-enoyloxy)propan-2-yl]carbamoyloxy]hexan-2-yl]oxymethylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [2-[[1-hydroxy-6-[[2-methyl-1,3-di(prop-2-enoyloxy)propan-2-yl]carbamoyloxy]hexan-2-yl]oxymethylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 121441383 |
| Molecular Formula | C28H42N2O12 |
| Molecular Weight | 598.65 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | [2-[[1-hydroxy-6-[[2-methyl-1,3-di(prop-2-enoyloxy)propan-2-yl]carbamoyloxy]hexan-2-yl]oxymethylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(COC(=O)C=C)NCOC(CO)CCCCOC(=O)NC(C)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C28H42N2O12/c1-7-22(32)38-16-27(5,17-39-23(33)8-2)29-20-42-21(15-31)13-11-12-14-37-26(36)30-28(6,18-40-24(34)9-3)19-41-25(35)10-4/h7-10,21,29,31H,1-4,11-20H2,5-6H3,(H,30,36) |
| InChIKey | CHDLLXLUOURGDC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 185.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.65 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|