C17H26N4O4S — CID 1214448
ethyl 4-(3-piperidin-1-ylsulfonyl-4-pyridinyl)piperazine-1-carboxylate (PubChem CID 1214448) has the molecular formula C17H26N4O4S and a molecular weight of 382.49 g/mol. Its IUPAC name is ethyl 4-(3-piperidin-1-ylsulfonyl-4-pyridinyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(3-piperidin-1-ylsulfonyl-4-pyridinyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 1214448 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | ethyl 4-(3-piperidin-1-ylsulfonyl-4-pyridinyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccncc2S(=O)(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C17H26N4O4S/c1-2-25-17(22)20-12-10-19(11-13-20)15-6-7-18-14-16(15)26(23,24)21-8-4-3-5-9-21/h6-7,14H,2-5,8-13H2,1H3 |
| InChIKey | FVUBCWZZHCIGMD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |