C23H32O4 — CID 121445010
(1S,6S,8S,12R,15R)-10,10,15-trimethyl-7-methylidene-9,11,17-trioxahexacyclo[13.3.3.12,6.01,14.03,8.03,12]docosan-18-one (PubChem CID 121445010) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (1S,6S,8S,12R,15R)-10,10,15-trimethyl-7-methylidene-9,11,17-trioxahexacyclo[13.3.3.12,6.01,14.03,8.03,12]docosan-18-one.
| Compound Name | (1S,6S,8S,12R,15R)-10,10,15-trimethyl-7-methylidene-9,11,17-trioxahexacyclo[13.3.3.12,6.01,14.03,8.03,12]docosan-18-one |
|---|---|
| PubChem CID | 121445010 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (1S,6S,8S,12R,15R)-10,10,15-trimethyl-7-methylidene-9,11,17-trioxahexacyclo[13.3.3.12,6.01,14.03,8.03,12]docosan-18-one |
| SMILES | C=C1[C@H]2CCC34C(C2)[C@@]25CCC[C@@](C)(COC2=O)C5C[C@H]3OC(C)(C)O[C@@H]14 |
| InChI | InChI=1S/C23H32O4/c1-13-14-6-9-23-16(10-14)22-8-5-7-21(4,12-25-19(22)24)15(22)11-17(23)26-20(2,3)27-18(13)23/h14-18H,1,5-12H2,2-4H3/t14-,15?,16?,17+,18-,21-,22-,23?/m0/s1 |
| InChIKey | JUCTZEFFFASCBT-VMXYCDCUSA-N |
| XLogP | 4.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|