C28H32O6 — CID 72544261
[(4S,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] 4-methoxybenzoate (PubChem CID 72544261) has the molecular formula C28H32O6 and a molecular weight of 464.56 g/mol. Its IUPAC name is [(4S,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] 4-methoxybenzoate.
| Compound Name | [(4S,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 72544261 |
| Molecular Formula | C28H32O6 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | [(4S,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] 4-methoxybenzoate |
| SMILES | C=C1C(=O)C23CC[C@H]1CC2C12CCC[C@@](C)(COC1=O)C2C[C@H]3OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H32O6/c1-16-18-9-12-28(23(16)29)21(13-18)27-11-4-10-26(2,15-33-25(27)31)20(27)14-22(28)34-24(30)17-5-7-19(32-3)8-6-17/h5-8,18,20-22H,1,4,9-15H2,2-3H3/t18-,20?,21?,22+,26-,27?,28?/m0/s1 |
| InChIKey | JSSNTZGPJKATBG-LBJXNOKISA-N |
| XLogP | 4.52 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|