C26H30O6 — CID 123905726
(11,12-dimethyl-5-methylidene-6,16-dioxo-17-oxapentacyclo[10.3.2.24,7.01,10.02,7]nonadecan-8-yl) furan-2-carboxylate (PubChem CID 123905726) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is (11,12-dimethyl-5-methylidene-6,16-dioxo-17-oxapentacyclo[10.3.2.24,7.01,10.02,7]nonadecan-8-yl) furan-2-carboxylate.
| Compound Name | (11,12-dimethyl-5-methylidene-6,16-dioxo-17-oxapentacyclo[10.3.2.24,7.01,10.02,7]nonadecan-8-yl) furan-2-carboxylate |
|---|---|
| PubChem CID | 123905726 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (11,12-dimethyl-5-methylidene-6,16-dioxo-17-oxapentacyclo[10.3.2.24,7.01,10.02,7]nonadecan-8-yl) furan-2-carboxylate |
| SMILES | C=C1C(=O)C23CCC1CC2C12CCCC(C)(OC1=O)C(C)C2CC3OC(=O)c1ccco1 |
| InChI | InChI=1S/C26H30O6/c1-14-16-7-10-26(21(14)27)19(12-16)25-9-5-8-24(3,32-23(25)29)15(2)17(25)13-20(26)31-22(28)18-6-4-11-30-18/h4,6,11,15-17,19-20H,1,5,7-10,12-13H2,2-3H3 |
| InChIKey | ULPPBBKZFYZKQM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|