C15H20O4S — CID 90974759
2-ethyl-1-(furan-2-carbonyloxy)-2,3-dimethylcyclopentane-1-carbothioic S-acid (PubChem CID 90974759) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-ethyl-1-(furan-2-carbonyloxy)-2,3-dimethylcyclopentane-1-carbothioic S-acid.
| Compound Name | 2-ethyl-1-(furan-2-carbonyloxy)-2,3-dimethylcyclopentane-1-carbothioic S-acid |
|---|---|
| PubChem CID | 90974759 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-ethyl-1-(furan-2-carbonyloxy)-2,3-dimethylcyclopentane-1-carbothioic S-acid |
| SMILES | CCC1(C)C(C)CCC1(OC(=O)c1ccco1)C(=O)S |
| InChI | InChI=1S/C15H20O4S/c1-4-14(3)10(2)7-8-15(14,13(17)20)19-12(16)11-6-5-9-18-11/h5-6,9-10H,4,7-8H2,1-3H3,(H,17,20) |
| InChIKey | BNAWEHGHONRQFZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|