C28H34N2O5S — CID 91282753
[5,6,7a-trimethyl-1-[2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)acetyl]-4-propyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-yl] furan-2-carboxylate (PubChem CID 91282753) has the molecular formula C28H34N2O5S and a molecular weight of 510.66 g/mol. Its IUPAC name is [5,6,7a-trimethyl-1-[2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)acetyl]-4-propyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-yl] furan-2-carboxylate.
| Compound Name | [5,6,7a-trimethyl-1-[2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)acetyl]-4-propyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 91282753 |
| Molecular Formula | C28H34N2O5S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | [5,6,7a-trimethyl-1-[2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)acetyl]-4-propyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-yl] furan-2-carboxylate |
| SMILES | CCCC1C(C)C(C)CC2(C)C1CCC2(OC(=O)c1ccco1)C(=O)CSc1nc2ncccc2o1 |
| InChI | InChI=1S/C28H34N2O5S/c1-5-8-19-18(3)17(2)15-27(4)20(19)11-12-28(27,35-25(32)22-10-7-14-33-22)23(31)16-36-26-30-24-21(34-26)9-6-13-29-24/h6-7,9-10,13-14,17-20H,5,8,11-12,15-16H2,1-4H3 |
| InChIKey | PASNEFAOMVOIMD-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 95.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |