C16H9Br2I — CID 121450064
2-(3,5-dibromophenyl)-6-iodonaphthalene (PubChem CID 121450064) has the molecular formula C16H9Br2I and a molecular weight of 487.96 g/mol. Its IUPAC name is 2-(3,5-dibromophenyl)-6-iodonaphthalene.
| Compound Name | 2-(3,5-dibromophenyl)-6-iodonaphthalene |
|---|---|
| PubChem CID | 121450064 |
| Molecular Formula | C16H9Br2I |
| Molecular Weight | 487.96 g/mol |
| Exact Mass | 485.81 |
| IUPAC Name | 2-(3,5-dibromophenyl)-6-iodonaphthalene |
| SMILES | Brc1cc(Br)cc(-c2ccc3cc(I)ccc3c2)c1 |
| InChI | InChI=1S/C16H9Br2I/c17-14-6-13(7-15(18)9-14)11-1-2-12-8-16(19)4-3-10(12)5-11/h1-9H |
| InChIKey | LTUDNKMSPVDMPV-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.96 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|