C11H18N4 — CID 121451039
2-(4-amino-1-phenylbutyl)guanidine (PubChem CID 121451039) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(4-amino-1-phenylbutyl)guanidine.
| Compound Name | 2-(4-amino-1-phenylbutyl)guanidine |
|---|---|
| PubChem CID | 121451039 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-(4-amino-1-phenylbutyl)guanidine |
| SMILES | NCCCC(N=C(N)N)c1ccccc1 |
| InChI | InChI=1S/C11H18N4/c12-8-4-7-10(15-11(13)14)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8,12H2,(H4,13,14,15) |
| InChIKey | XWRRAEGQQLAWEA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|