C25H26N2O3 — CID 121454722
(2S)-2-amino-3-[4-[3-(2-phenylphenyl)propylcarbamoyl]phenyl]propanoic acid (PubChem CID 121454722) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[3-(2-phenylphenyl)propylcarbamoyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[3-(2-phenylphenyl)propylcarbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 121454722 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (2S)-2-amino-3-[4-[3-(2-phenylphenyl)propylcarbamoyl]phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(C(=O)NCCCc2ccccc2-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C25H26N2O3/c26-23(25(29)30)17-18-12-14-21(15-13-18)24(28)27-16-6-10-20-9-4-5-11-22(20)19-7-2-1-3-8-19/h1-5,7-9,11-15,23H,6,10,16-17,26H2,(H,27,28)(H,29,30)/t23-/m0/s1 |
| InChIKey | GHOSHQPZENYZQL-QHCPKHFHSA-N |
| XLogP | 3.67 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|