C26H26N2O5 — CID 121454725
2-amino-3-[4-[3-[2-(1,3-benzodioxol-5-yl)phenyl]propylcarbamoyl]phenyl]propanoic acid (PubChem CID 121454725) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-amino-3-[4-[3-[2-(1,3-benzodioxol-5-yl)phenyl]propylcarbamoyl]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[3-[2-(1,3-benzodioxol-5-yl)phenyl]propylcarbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 121454725 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-amino-3-[4-[3-[2-(1,3-benzodioxol-5-yl)phenyl]propylcarbamoyl]phenyl]propanoic acid |
| SMILES | NC(Cc1ccc(C(=O)NCCCc2ccccc2-c2ccc3c(c2)OCO3)cc1)C(=O)O |
| InChI | InChI=1S/C26H26N2O5/c27-22(26(30)31)14-17-7-9-19(10-8-17)25(29)28-13-3-5-18-4-1-2-6-21(18)20-11-12-23-24(15-20)33-16-32-23/h1-2,4,6-12,15,22H,3,5,13-14,16,27H2,(H,28,29)(H,30,31) |
| InChIKey | AXNJAIUPWVHCTF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|