C17H14N4O2 — CID 121457438
5-[4-(methylamino)imidazo[1,2-a]quinoxalin-1-yl]benzene-1,3-diol (PubChem CID 121457438) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 5-[4-(methylamino)imidazo[1,2-a]quinoxalin-1-yl]benzene-1,3-diol.
| Compound Name | 5-[4-(methylamino)imidazo[1,2-a]quinoxalin-1-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 121457438 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 5-[4-(methylamino)imidazo[1,2-a]quinoxalin-1-yl]benzene-1,3-diol |
| SMILES | CNc1nc2ccccc2n2c(-c3cc(O)cc(O)c3)cnc12 |
| InChI | InChI=1S/C17H14N4O2/c1-18-16-17-19-9-15(10-6-11(22)8-12(23)7-10)21(17)14-5-3-2-4-13(14)20-16/h2-9,22-23H,1H3,(H,18,20) |
| InChIKey | VSJRCIRSFNEPRC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |