About [4-(butylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol
[4-(butylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol (PubChem CID 141155093) has the molecular formula C15H18N4O
and a molecular weight of 270.34 g/mol. Its IUPAC name is [4-(butylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol.
Molecular Properties
| Compound Name | [4-(butylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol |
| PubChem CID | 141155093 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [4-(butylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol |
| SMILES | CCCCNc1nc2ccccc2n2c(CO)cnc12 |
| InChI | InChI=1S/C15H18N4O/c1-2-3-8-16-14-15-17-9-11(10-20)19(15)13-7-5-4-6-12(13)18-14/h4-7,9,20H,2-3,8,10H2,1H3,(H,16,18) |
| InChIKey | JPQSFBJSXINVNO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-(butylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(butylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol?
The IUPAC name of [4-(butylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol (CID 141155093) is [4-(butylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol.
What is the SMILES notation for [4-(butylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol?
The canonical SMILES for [4-(butylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol is CCCCNc1nc2ccccc2n2c(CO)cnc12.
What is the InChIKey of [4-(butylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol?
The InChIKey is JPQSFBJSXINVNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O/c1-2-3-8-16-14-15-17-9-11(10-20)19(15)13-7-5-4-6-12(13)18-14/h4-7,9,20H,2-3,8,10H2,1H3,(H,16,18).
What are the key properties of [4-(butylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol?
[4-(butylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol has a molecular weight of 270.34 g/mol, XLogP of 2.59, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(butylamino)imidazo[1,2-a]quinoxalin-1-yl]methanol is sourced from PubChem (CID 141155093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).