C17H15N5O2 — CID 137051940
4-[6-amino-4-(methylamino)imidazo[1,2-a]quinoxalin-1-yl]benzene-1,2-diol (PubChem CID 137051940) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is 4-[6-amino-4-(methylamino)imidazo[1,2-a]quinoxalin-1-yl]benzene-1,2-diol.
| Compound Name | 4-[6-amino-4-(methylamino)imidazo[1,2-a]quinoxalin-1-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 137051940 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 4-[6-amino-4-(methylamino)imidazo[1,2-a]quinoxalin-1-yl]benzene-1,2-diol |
| SMILES | CNc1nc2c(N)cccc2n2c(-c3ccc(O)c(O)c3)cnc12 |
| InChI | InChI=1S/C17H15N5O2/c1-19-16-17-20-8-12(9-5-6-13(23)14(24)7-9)22(17)11-4-2-3-10(18)15(11)21-16/h2-8,23-24H,18H2,1H3,(H,19,21) |
| InChIKey | QLCJXYIJVDAHPR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|