C18H18N6O2 — CID 137051950
4-[8-amino-4-(2-aminoethylamino)imidazo[1,2-a]quinoxalin-1-yl]benzene-1,2-diol (PubChem CID 137051950) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 4-[8-amino-4-(2-aminoethylamino)imidazo[1,2-a]quinoxalin-1-yl]benzene-1,2-diol.
| Compound Name | 4-[8-amino-4-(2-aminoethylamino)imidazo[1,2-a]quinoxalin-1-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 137051950 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-[8-amino-4-(2-aminoethylamino)imidazo[1,2-a]quinoxalin-1-yl]benzene-1,2-diol |
| SMILES | NCCNc1nc2ccc(N)cc2n2c(-c3ccc(O)c(O)c3)cnc12 |
| InChI | InChI=1S/C18H18N6O2/c19-5-6-21-17-18-22-9-14(10-1-4-15(25)16(26)7-10)24(18)13-8-11(20)2-3-12(13)23-17/h1-4,7-9,25-26H,5-6,19-20H2,(H,21,23) |
| InChIKey | XMJLGPQXVKVLFA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 134.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|