C19H21N5OS — CID 20823946
1-[3-[8-(2-aminoethylamino)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]ethanol (PubChem CID 20823946) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is 1-[3-[8-(2-aminoethylamino)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]ethanol.
| Compound Name | 1-[3-[8-(2-aminoethylamino)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]ethanol |
|---|---|
| PubChem CID | 20823946 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-[3-[8-(2-aminoethylamino)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]ethanol |
| SMILES | Cc1cnc2c(NCCN)nc3cc(-c4cccc(C(C)O)c4)sc3n12 |
| InChI | InChI=1S/C19H21N5OS/c1-11-10-22-18-17(21-7-6-20)23-15-9-16(26-19(15)24(11)18)14-5-3-4-13(8-14)12(2)25/h3-5,8-10,12,25H,6-7,20H2,1-2H3,(H,21,23) |
| InChIKey | QUERRESFTHXWCE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |