C18H14N4O4 — CID 140836188
methyl 4-amino-1-(3,4-dihydroxyphenyl)imidazo[1,2-a]quinoxaline-8-carboxylate (PubChem CID 140836188) has the molecular formula C18H14N4O4 and a molecular weight of 350.33 g/mol. Its IUPAC name is methyl 4-amino-1-(3,4-dihydroxyphenyl)imidazo[1,2-a]quinoxaline-8-carboxylate.
| Compound Name | methyl 4-amino-1-(3,4-dihydroxyphenyl)imidazo[1,2-a]quinoxaline-8-carboxylate |
|---|---|
| PubChem CID | 140836188 |
| Molecular Formula | C18H14N4O4 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | methyl 4-amino-1-(3,4-dihydroxyphenyl)imidazo[1,2-a]quinoxaline-8-carboxylate |
| SMILES | COC(=O)c1ccc2nc(N)c3ncc(-c4ccc(O)c(O)c4)n3c2c1 |
| InChI | InChI=1S/C18H14N4O4/c1-26-18(25)10-2-4-11-12(6-10)22-13(8-20-17(22)16(19)21-11)9-3-5-14(23)15(24)7-9/h2-8,23-24H,1H3,(H2,19,21) |
| InChIKey | ZWHCRCWRMHXQHN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|