C15H11I2N3O3S — CID 121459639
3-iodo-N-[(4-iodo-2-nitrophenyl)carbamothioyl]-5-methylbenzamide (PubChem CID 121459639) has the molecular formula C15H11I2N3O3S and a molecular weight of 567.15 g/mol. Its IUPAC name is 3-iodo-N-[(4-iodo-2-nitrophenyl)carbamothioyl]-5-methylbenzamide.
| Compound Name | 3-iodo-N-[(4-iodo-2-nitrophenyl)carbamothioyl]-5-methylbenzamide |
|---|---|
| PubChem CID | 121459639 |
| Molecular Formula | C15H11I2N3O3S |
| Molecular Weight | 567.15 g/mol |
| Exact Mass | 566.86 |
| IUPAC Name | 3-iodo-N-[(4-iodo-2-nitrophenyl)carbamothioyl]-5-methylbenzamide |
| SMILES | Cc1cc(I)cc(C(=O)NC(=S)Nc2ccc(I)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11I2N3O3S/c1-8-4-9(6-11(17)5-8)14(21)19-15(24)18-12-3-2-10(16)7-13(12)20(22)23/h2-7H,1H3,(H2,18,19,21,24) |
| InChIKey | CTIFUJLVMFOYBW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.15 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|