C24H33FO3 — CID 121466013
1-[(2S,3R,4S)-4-butoxy-2-(2-methoxyethyl)-3-phenoxypentyl]-4-fluorobenzene (PubChem CID 121466013) has the molecular formula C24H33FO3 and a molecular weight of 388.52 g/mol. Its IUPAC name is 1-[(2S,3R,4S)-4-butoxy-2-(2-methoxyethyl)-3-phenoxypentyl]-4-fluorobenzene.
| Compound Name | 1-[(2S,3R,4S)-4-butoxy-2-(2-methoxyethyl)-3-phenoxypentyl]-4-fluorobenzene |
|---|---|
| PubChem CID | 121466013 |
| Molecular Formula | C24H33FO3 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 1-[(2S,3R,4S)-4-butoxy-2-(2-methoxyethyl)-3-phenoxypentyl]-4-fluorobenzene |
| SMILES | CCCCO[C@@H](C)[C@H](Oc1ccccc1)[C@H](CCOC)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H33FO3/c1-4-5-16-27-19(2)24(28-23-9-7-6-8-10-23)21(15-17-26-3)18-20-11-13-22(25)14-12-20/h6-14,19,21,24H,4-5,15-18H2,1-3H3/t19-,21+,24-/m0/s1 |
| InChIKey | FPLYDQMDSXDQMO-LEEZEASISA-N |
| XLogP | 5.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|