C25H18N2O — CID 1214706
(2R,13R)-8-methyl-4,11-diazaheptacyclo[12.6.6.02,13.03,11.05,10.015,20.021,26]hexacosa-3,5(10),6,8,15,17,19,21,23,25-decaen-12-one (PubChem CID 1214706) has the molecular formula C25H18N2O and a molecular weight of 362.43 g/mol. Its IUPAC name is (2R,13R)-8-methyl-4,11-diazaheptacyclo[12.6.6.02,13.03,11.05,10.015,20.021,26]hexacosa-3,5(10),6,8,15,17,19,21,23,25-decaen-12-one.
| Compound Name | (2R,13R)-8-methyl-4,11-diazaheptacyclo[12.6.6.02,13.03,11.05,10.015,20.021,26]hexacosa-3,5(10),6,8,15,17,19,21,23,25-decaen-12-one |
|---|---|
| PubChem CID | 1214706 |
| Molecular Formula | C25H18N2O |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (2R,13R)-8-methyl-4,11-diazaheptacyclo[12.6.6.02,13.03,11.05,10.015,20.021,26]hexacosa-3,5(10),6,8,15,17,19,21,23,25-decaen-12-one |
| SMILES | Cc1ccc2nc3n(c2c1)C(=O)[C@@H]1C2c4ccccc4C(c4ccccc42)[C@@H]31 |
| InChI | InChI=1S/C25H18N2O/c1-13-10-11-18-19(12-13)27-24(26-18)22-20-14-6-2-4-8-16(14)21(23(22)25(27)28)17-9-5-3-7-15(17)20/h2-12,20-23H,1H3/t20?,21?,22-,23-/m1/s1 |
| InChIKey | AEVLAQMBVRXWGD-BWWMBTDCSA-N |
| XLogP | 4.99 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |