C44H58O8 — CID 121474288
4-O-[2-ethynyl-4-[1-ethynyl-4-(4-pentylcyclohexyl)cyclohexyl]oxycarbonylphenyl] 1-O-[4-(2-methylprop-2-enoyloxy)butyl] cyclohexane-1,4-dicarboxylate (PubChem CID 121474288) has the molecular formula C44H58O8 and a molecular weight of 714.94 g/mol. Its IUPAC name is 4-O-[2-ethynyl-4-[1-ethynyl-4-(4-pentylcyclohexyl)cyclohexyl]oxycarbonylphenyl] 1-O-[4-(2-methylprop-2-enoyloxy)butyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[2-ethynyl-4-[1-ethynyl-4-(4-pentylcyclohexyl)cyclohexyl]oxycarbonylphenyl] 1-O-[4-(2-methylprop-2-enoyloxy)butyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 121474288 |
| Molecular Formula | C44H58O8 |
| Molecular Weight | 714.94 g/mol |
| Exact Mass | 714.41 |
| IUPAC Name | 4-O-[2-ethynyl-4-[1-ethynyl-4-(4-pentylcyclohexyl)cyclohexyl]oxycarbonylphenyl] 1-O-[4-(2-methylprop-2-enoyloxy)butyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C#Cc1cc(C(=O)OC2(C#C)CCC(C3CCC(CCCCC)CC3)CC2)ccc1OC(=O)C1CCC(C(=O)OCCCCOC(=O)C(=C)C)CC1 |
| InChI | InChI=1S/C44H58O8/c1-6-9-10-13-32-14-16-34(17-15-32)35-24-26-44(8-3,27-25-35)52-43(48)38-22-23-39(33(7-2)30-38)51-42(47)37-20-18-36(19-21-37)41(46)50-29-12-11-28-49-40(45)31(4)5/h2-3,22-23,30,32,34-37H,4,6,9-21,24-29H2,1,5H3 |
| InChIKey | UNACFPSGSNLABB-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.94 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|