C49H64O8 — CID 122413856
4-O-[4-[4-(4-pentylcyclohexyl)-1-(2-phenylethynyl)cyclohexyl]oxycarbonylphenyl] 1-O-(6-prop-2-enoyloxyhexyl) cyclohexane-1,4-dicarboxylate (PubChem CID 122413856) has the molecular formula C49H64O8 and a molecular weight of 781.04 g/mol. Its IUPAC name is 4-O-[4-[4-(4-pentylcyclohexyl)-1-(2-phenylethynyl)cyclohexyl]oxycarbonylphenyl] 1-O-(6-prop-2-enoyloxyhexyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[4-[4-(4-pentylcyclohexyl)-1-(2-phenylethynyl)cyclohexyl]oxycarbonylphenyl] 1-O-(6-prop-2-enoyloxyhexyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 122413856 |
| Molecular Formula | C49H64O8 |
| Molecular Weight | 781.04 g/mol |
| Exact Mass | 780.46 |
| IUPAC Name | 4-O-[4-[4-(4-pentylcyclohexyl)-1-(2-phenylethynyl)cyclohexyl]oxycarbonylphenyl] 1-O-(6-prop-2-enoyloxyhexyl) cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCCCOC(=O)C1CCC(C(=O)Oc2ccc(C(=O)OC3(C#Cc4ccccc4)CCC(C4CCC(CCCCC)CC4)CC3)cc2)CC1 |
| InChI | InChI=1S/C49H64O8/c1-3-5-9-14-38-17-19-39(20-18-38)40-30-33-49(34-31-40,32-29-37-15-10-8-11-16-37)57-48(53)43-25-27-44(28-26-43)56-47(52)42-23-21-41(22-24-42)46(51)55-36-13-7-6-12-35-54-45(50)4-2/h4,8,10-11,15-16,25-28,38-42H,2-3,5-7,9,12-14,17-24,30-31,33-36H2,1H3 |
| InChIKey | JZQLXNYELXBDNE-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.04 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|