C21H22Cl2FN7O — CID 121478270
2-[5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-7,8-dihydro-6H-pyrazino[2,3-c]pyridazin-3-yl]-5-piperidin-4-yl-1,3,4-oxadiazole (PubChem CID 121478270) has the molecular formula C21H22Cl2FN7O and a molecular weight of 478.36 g/mol. Its IUPAC name is 2-[5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-7,8-dihydro-6H-pyrazino[2,3-c]pyridazin-3-yl]-5-piperidin-4-yl-1,3,4-oxadiazole.
| Compound Name | 2-[5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-7,8-dihydro-6H-pyrazino[2,3-c]pyridazin-3-yl]-5-piperidin-4-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 121478270 |
| Molecular Formula | C21H22Cl2FN7O |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 2-[5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-7,8-dihydro-6H-pyrazino[2,3-c]pyridazin-3-yl]-5-piperidin-4-yl-1,3,4-oxadiazole |
| SMILES | C[C@H](c1c(Cl)ccc(F)c1Cl)N1CCNc2nnc(-c3nnc(C4CCNCC4)o3)cc21 |
| InChI | InChI=1S/C21H22Cl2FN7O/c1-11(17-13(22)2-3-14(24)18(17)23)31-9-8-26-19-16(31)10-15(27-28-19)21-30-29-20(32-21)12-4-6-25-7-5-12/h2-3,10-12,25H,4-9H2,1H3,(H,26,28)/t11-/m1/s1 |
| InChIKey | RBKIHRXGURBCIM-LLVKDONJSA-N |
| XLogP | 4.43 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|