C19H20Cl2FN7 — CID 121478135
5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)-7,8-dihydro-6H-pyrazino[2,3-c]pyridazine (PubChem CID 121478135) has the molecular formula C19H20Cl2FN7 and a molecular weight of 436.32 g/mol. Its IUPAC name is 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)-7,8-dihydro-6H-pyrazino[2,3-c]pyridazine.
| Compound Name | 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)-7,8-dihydro-6H-pyrazino[2,3-c]pyridazine |
|---|---|
| PubChem CID | 121478135 |
| Molecular Formula | C19H20Cl2FN7 |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-3-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)-7,8-dihydro-6H-pyrazino[2,3-c]pyridazine |
| SMILES | CC(C)c1nc(-c2cc3c(nn2)NCCN3[C@H](C)c2c(Cl)ccc(F)c2Cl)n[nH]1 |
| InChI | InChI=1S/C19H20Cl2FN7/c1-9(2)17-24-18(27-26-17)13-8-14-19(28-25-13)23-6-7-29(14)10(3)15-11(20)4-5-12(22)16(15)21/h4-5,8-10H,6-7H2,1-3H3,(H,23,28)(H,24,26,27)/t10-/m1/s1 |
| InChIKey | NZHGNATZNMOSEK-SNVBAGLBSA-N |
| XLogP | 4.82 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|