C26H27Cl2FN6O2 — CID 121478225
[4-[[5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-7,8-dihydro-6H-pyrazino[2,3-c]pyridazin-3-yl]amino]-3-methoxyphenyl]-pyrrolidin-1-ylmethanone (PubChem CID 121478225) has the molecular formula C26H27Cl2FN6O2 and a molecular weight of 545.45 g/mol. Its IUPAC name is [4-[[5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-7,8-dihydro-6H-pyrazino[2,3-c]pyridazin-3-yl]amino]-3-methoxyphenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[[5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-7,8-dihydro-6H-pyrazino[2,3-c]pyridazin-3-yl]amino]-3-methoxyphenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 121478225 |
| Molecular Formula | C26H27Cl2FN6O2 |
| Molecular Weight | 545.45 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | [4-[[5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethyl]-7,8-dihydro-6H-pyrazino[2,3-c]pyridazin-3-yl]amino]-3-methoxyphenyl]-pyrrolidin-1-ylmethanone |
| SMILES | COc1cc(C(=O)N2CCCC2)ccc1Nc1cc2c(nn1)NCCN2[C@H](C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C26H27Cl2FN6O2/c1-15(23-17(27)6-7-18(29)24(23)28)35-12-9-30-25-20(35)14-22(32-33-25)31-19-8-5-16(13-21(19)37-2)26(36)34-10-3-4-11-34/h5-8,13-15H,3-4,9-12H2,1-2H3,(H,30,33)(H,31,32)/t15-/m1/s1 |
| InChIKey | NIGCLDGWYWISPT-OAHLLOKOSA-N |
| XLogP | 5.90 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.45 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|