C11H24N2 — CID 121478340
(2S,5S)-1-butyl-2,4,5-trimethylpiperazine (PubChem CID 121478340) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is (2S,5S)-1-butyl-2,4,5-trimethylpiperazine.
| Compound Name | (2S,5S)-1-butyl-2,4,5-trimethylpiperazine |
|---|---|
| PubChem CID | 121478340 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | (2S,5S)-1-butyl-2,4,5-trimethylpiperazine |
| SMILES | CCCCN1C[C@H](C)N(C)C[C@@H]1C |
| InChI | InChI=1S/C11H24N2/c1-5-6-7-13-9-10(2)12(4)8-11(13)3/h10-11H,5-9H2,1-4H3/t10-,11-/m0/s1 |
| InChIKey | BSJADTBSMKUABB-QWRGUYRKSA-N |
| XLogP | 1.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |