C9H21ClN2 — CID 174751170
1-butyl-2,3-dimethylimidazolidine;hydrochloride (PubChem CID 174751170) has the molecular formula C9H21ClN2 and a molecular weight of 192.73 g/mol. Its IUPAC name is 1-butyl-2,3-dimethylimidazolidine;hydrochloride.
| Compound Name | 1-butyl-2,3-dimethylimidazolidine;hydrochloride |
|---|---|
| PubChem CID | 174751170 |
| Molecular Formula | C9H21ClN2 |
| Molecular Weight | 192.73 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1-butyl-2,3-dimethylimidazolidine;hydrochloride |
| SMILES | CCCCN1CCN(C)C1C.Cl |
| InChI | InChI=1S/C9H20N2.ClH/c1-4-5-6-11-8-7-10(3)9(11)2;/h9H,4-8H2,1-3H3;1H |
| InChIKey | BVRFPJMWSQWCBN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.73 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |