About 1-butyl-2,3-dimethylimidazolidine;hydrochloride
1-butyl-2,3-dimethylimidazolidine;hydrochloride (PubChem CID 174751170) has the molecular formula C9H21ClN2
and a molecular weight of 192.73 g/mol. Its IUPAC name is 1-butyl-2,3-dimethylimidazolidine;hydrochloride.
Molecular Properties
| Compound Name | 1-butyl-2,3-dimethylimidazolidine;hydrochloride |
| PubChem CID | 174751170 |
| Molecular Formula | C9H21ClN2 |
| Molecular Weight | 192.73 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1-butyl-2,3-dimethylimidazolidine;hydrochloride |
| SMILES | CCCCN1CCN(C)C1C.Cl |
| InChI | InChI=1S/C9H20N2.ClH/c1-4-5-6-11-8-7-10(3)9(11)2;/h9H,4-8H2,1-3H3;1H |
| InChIKey | BVRFPJMWSQWCBN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.73 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butyl-2,3-dimethylimidazolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2,3-dimethylimidazolidine;hydrochloride?
The IUPAC name of 1-butyl-2,3-dimethylimidazolidine;hydrochloride (CID 174751170) is 1-butyl-2,3-dimethylimidazolidine;hydrochloride.
What is the SMILES notation for 1-butyl-2,3-dimethylimidazolidine;hydrochloride?
The canonical SMILES for 1-butyl-2,3-dimethylimidazolidine;hydrochloride is CCCCN1CCN(C)C1C.Cl.
What is the InChIKey of 1-butyl-2,3-dimethylimidazolidine;hydrochloride?
The InChIKey is BVRFPJMWSQWCBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2.ClH/c1-4-5-6-11-8-7-10(3)9(11)2;/h9H,4-8H2,1-3H3;1H.
What are the key properties of 1-butyl-2,3-dimethylimidazolidine;hydrochloride?
1-butyl-2,3-dimethylimidazolidine;hydrochloride has a molecular weight of 192.73 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2,3-dimethylimidazolidine;hydrochloride is sourced from PubChem (CID 174751170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).