C18H36N4O4 — CID 173181854
but-2-enedioic acid;bis(1-ethyl-2,3-dimethylimidazolidine) (PubChem CID 173181854) has the molecular formula C18H36N4O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is but-2-enedioic acid;bis(1-ethyl-2,3-dimethylimidazolidine).
| Compound Name | but-2-enedioic acid;bis(1-ethyl-2,3-dimethylimidazolidine) |
|---|---|
| PubChem CID | 173181854 |
| Molecular Formula | C18H36N4O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | but-2-enedioic acid;bis(1-ethyl-2,3-dimethylimidazolidine) |
| SMILES | CCN1CCN(C)C1C.CCN1CCN(C)C1C.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/2C7H16N2.C4H4O4/c2*1-4-9-6-5-8(3)7(9)2;5-3(6)1-2-4(7)8/h2*7H,4-6H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | LTTDHFISMVIXEZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|