C7H17ClN2 — CID 174740578
1-ethyl-2,3-dimethylimidazolidine;hydrochloride (PubChem CID 174740578) has the molecular formula C7H17ClN2 and a molecular weight of 164.68 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethylimidazolidine;hydrochloride.
| Compound Name | 1-ethyl-2,3-dimethylimidazolidine;hydrochloride |
|---|---|
| PubChem CID | 174740578 |
| Molecular Formula | C7H17ClN2 |
| Molecular Weight | 164.68 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 1-ethyl-2,3-dimethylimidazolidine;hydrochloride |
| SMILES | CCN1CCN(C)C1C.Cl |
| InChI | InChI=1S/C7H16N2.ClH/c1-4-9-6-5-8(3)7(9)2;/h7H,4-6H2,1-3H3;1H |
| InChIKey | PCEUAFZINBHBLK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.68 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |