C7H16ClFN2 — CID 173248152
1,3-diethyl-2-fluoroimidazolidine;hydrochloride (PubChem CID 173248152) has the molecular formula C7H16ClFN2 and a molecular weight of 182.67 g/mol. Its IUPAC name is 1,3-diethyl-2-fluoroimidazolidine;hydrochloride.
| Compound Name | 1,3-diethyl-2-fluoroimidazolidine;hydrochloride |
|---|---|
| PubChem CID | 173248152 |
| Molecular Formula | C7H16ClFN2 |
| Molecular Weight | 182.67 g/mol |
| Exact Mass | 182.10 |
| IUPAC Name | 1,3-diethyl-2-fluoroimidazolidine;hydrochloride |
| SMILES | CCN1CCN(CC)C1F.Cl |
| InChI | InChI=1S/C7H15FN2.ClH/c1-3-9-5-6-10(4-2)7(9)8;/h7H,3-6H2,1-2H3;1H |
| InChIKey | WKGLJGSAUDVNCR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.67 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|