C23H29NO2 — CID 121479288
(1-cyclopentylpiperidin-3-yl)-[4-(1-hydroxyethyl)naphthalen-2-yl]methanone (PubChem CID 121479288) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (1-cyclopentylpiperidin-3-yl)-[4-(1-hydroxyethyl)naphthalen-2-yl]methanone.
| Compound Name | (1-cyclopentylpiperidin-3-yl)-[4-(1-hydroxyethyl)naphthalen-2-yl]methanone |
|---|---|
| PubChem CID | 121479288 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (1-cyclopentylpiperidin-3-yl)-[4-(1-hydroxyethyl)naphthalen-2-yl]methanone |
| SMILES | CC(O)c1cc(C(=O)C2CCCN(C3CCCC3)C2)cc2ccccc12 |
| InChI | InChI=1S/C23H29NO2/c1-16(25)22-14-19(13-17-7-2-5-11-21(17)22)23(26)18-8-6-12-24(15-18)20-9-3-4-10-20/h2,5,7,11,13-14,16,18,20,25H,3-4,6,8-10,12,15H2,1H3 |
| InChIKey | LNHKBDHVIVGUKO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |