C19H23NO2 — CID 145118570
[4-(1-hydroxyethyl)naphthalen-2-yl]-(1-methylpiperidin-3-yl)methanone (PubChem CID 145118570) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is [4-(1-hydroxyethyl)naphthalen-2-yl]-(1-methylpiperidin-3-yl)methanone.
| Compound Name | [4-(1-hydroxyethyl)naphthalen-2-yl]-(1-methylpiperidin-3-yl)methanone |
|---|---|
| PubChem CID | 145118570 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | [4-(1-hydroxyethyl)naphthalen-2-yl]-(1-methylpiperidin-3-yl)methanone |
| SMILES | CC(O)c1cc(C(=O)C2CCCN(C)C2)cc2ccccc12 |
| InChI | InChI=1S/C19H23NO2/c1-13(21)18-11-16(10-14-6-3-4-8-17(14)18)19(22)15-7-5-9-20(2)12-15/h3-4,6,8,10-11,13,15,21H,5,7,9,12H2,1-2H3 |
| InChIKey | SMDRAIALFHZCKP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |