C13H17ClN2O2 — CID 121481656
6-butoxy-4-chloro-7-methoxy-1,4-dihydroquinazoline (PubChem CID 121481656) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 6-butoxy-4-chloro-7-methoxy-1,4-dihydroquinazoline.
| Compound Name | 6-butoxy-4-chloro-7-methoxy-1,4-dihydroquinazoline |
|---|---|
| PubChem CID | 121481656 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 6-butoxy-4-chloro-7-methoxy-1,4-dihydroquinazoline |
| SMILES | CCCCOc1cc2c(cc1OC)NC=NC2Cl |
| InChI | InChI=1S/C13H17ClN2O2/c1-3-4-5-18-12-6-9-10(7-11(12)17-2)15-8-16-13(9)14/h6-8,13H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | JGCWDAHBSFMVEJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|