C15H19ClN6O3 — CID 121482338
[3-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]oxycyclohexyl]carbamic acid (PubChem CID 121482338) has the molecular formula C15H19ClN6O3 and a molecular weight of 366.81 g/mol. Its IUPAC name is [3-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]oxycyclohexyl]carbamic acid.
| Compound Name | [3-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]oxycyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 121482338 |
| Molecular Formula | C15H19ClN6O3 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [3-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]oxycyclohexyl]carbamic acid |
| SMILES | Cn1cc(Nc2ncc(Cl)c(OC3CCCC(NC(=O)O)C3)n2)cn1 |
| InChI | InChI=1S/C15H19ClN6O3/c1-22-8-10(6-18-22)19-14-17-7-12(16)13(21-14)25-11-4-2-3-9(5-11)20-15(23)24/h6-9,11,20H,2-5H2,1H3,(H,23,24)(H,17,19,21) |
| InChIKey | GQYHPFUSCPLTPC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |