C23H16N2 — CID 1217408
2,4-diphenyl-5H-indeno[1,2-d]pyrimidine (PubChem CID 1217408) has the molecular formula C23H16N2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2,4-diphenyl-5H-indeno[1,2-d]pyrimidine.
| Compound Name | 2,4-diphenyl-5H-indeno[1,2-d]pyrimidine |
|---|---|
| PubChem CID | 1217408 |
| Molecular Formula | C23H16N2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2,4-diphenyl-5H-indeno[1,2-d]pyrimidine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)c3c(n2)-c2ccccc2C3)cc1 |
| InChI | InChI=1S/C23H16N2/c1-3-9-16(10-4-1)21-20-15-18-13-7-8-14-19(18)22(20)25-23(24-21)17-11-5-2-6-12-17/h1-14H,15H2 |
| InChIKey | LAKCYKLNVYBDLF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |